C19H29N5 — CID 58227198
N-(1-adamantyl)-5-[(3S)-3-(methylamino)pyrrolidin-1-yl]pyridazin-3-amine (PubChem CID 58227198) has the molecular formula C19H29N5 and a molecular weight of 327.48 g/mol. Its IUPAC name is N-(1-adamantyl)-5-[(3S)-3-(methylamino)pyrrolidin-1-yl]pyridazin-3-amine.
| Compound Name | N-(1-adamantyl)-5-[(3S)-3-(methylamino)pyrrolidin-1-yl]pyridazin-3-amine |
|---|---|
| PubChem CID | 58227198 |
| Molecular Formula | C19H29N5 |
| Molecular Weight | 327.48 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | N-(1-adamantyl)-5-[(3S)-3-(methylamino)pyrrolidin-1-yl]pyridazin-3-amine |
| SMILES | CN[C@H]1CCN(c2cnnc(NC34CC5CC(CC(C5)C3)C4)c2)C1 |
| InChI | InChI=1S/C19H29N5/c1-20-16-2-3-24(12-16)17-7-18(23-21-11-17)22-19-8-13-4-14(9-19)6-15(5-13)10-19/h7,11,13-16,20H,2-6,8-10,12H2,1H3,(H,22,23)/t13?,14?,15?,16-,19?/m0/s1 |
| InChIKey | FUHRFMSATFWSDI-DZPQGLOJSA-N |
| XLogP | 2.66 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.48 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |