C17H29N5 — CID 130321945
N-(4-ethylhex-1-en-2-yl)-5-[(3R)-3-(methylamino)pyrrolidin-1-yl]pyridazin-3-amine (PubChem CID 130321945) has the molecular formula C17H29N5 and a molecular weight of 303.45 g/mol. Its IUPAC name is N-(4-ethylhex-1-en-2-yl)-5-[(3R)-3-(methylamino)pyrrolidin-1-yl]pyridazin-3-amine.
| Compound Name | N-(4-ethylhex-1-en-2-yl)-5-[(3R)-3-(methylamino)pyrrolidin-1-yl]pyridazin-3-amine |
|---|---|
| PubChem CID | 130321945 |
| Molecular Formula | C17H29N5 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.24 |
| IUPAC Name | N-(4-ethylhex-1-en-2-yl)-5-[(3R)-3-(methylamino)pyrrolidin-1-yl]pyridazin-3-amine |
| SMILES | C=C(CC(CC)CC)Nc1cc(N2CC[C@@H](NC)C2)cnn1 |
| InChI | InChI=1S/C17H29N5/c1-5-14(6-2)9-13(3)20-17-10-16(11-19-21-17)22-8-7-15(12-22)18-4/h10-11,14-15,18H,3,5-9,12H2,1-2,4H3,(H,20,21)/t15-/m1/s1 |
| InChIKey | ZZOTZUYGVQMIMU-OAHLLOKOSA-N |
| XLogP | 3.03 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |