C12H21N5 — CID 58227228
5-[(3R)-3-aminopyrrolidin-1-yl]-N-butylpyridazin-3-amine (PubChem CID 58227228) has the molecular formula C12H21N5 and a molecular weight of 235.33 g/mol. Its IUPAC name is 5-[(3R)-3-aminopyrrolidin-1-yl]-N-butylpyridazin-3-amine.
| Compound Name | 5-[(3R)-3-aminopyrrolidin-1-yl]-N-butylpyridazin-3-amine |
|---|---|
| PubChem CID | 58227228 |
| Molecular Formula | C12H21N5 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.18 |
| IUPAC Name | 5-[(3R)-3-aminopyrrolidin-1-yl]-N-butylpyridazin-3-amine |
| SMILES | CCCCNc1cc(N2CC[C@@H](N)C2)cnn1 |
| InChI | InChI=1S/C12H21N5/c1-2-3-5-14-12-7-11(8-15-16-12)17-6-4-10(13)9-17/h7-8,10H,2-6,9,13H2,1H3,(H,14,16)/t10-/m1/s1 |
| InChIKey | KGUAKOJZXYPVBY-SNVBAGLBSA-N |
| XLogP | 1.23 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|