C13H19AsF3N4 — CID 87167805
CID 87167805 (PubChem CID 87167805) has the molecular formula C13H19AsF3N4 and a molecular weight of 363.24 g/mol.
| Compound Name | CID 87167805 |
|---|---|
| PubChem CID | 87167805 |
| Molecular Formula | C13H19AsF3N4 |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | — |
| SMILES | C[As]C1CCN(c2cnnc(NCCCC(F)(F)F)c2)C1 |
| InChI | InChI=1S/C13H19AsF3N4/c1-14-10-3-6-21(9-10)11-7-12(20-19-8-11)18-5-2-4-13(15,16)17/h7-8,10H,2-6,9H2,1H3,(H,18,20) |
| InChIKey | MPBZNLNBEPERHO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|