C15H18AsN4 — CID 87167842
CID 87167842 (PubChem CID 87167842) has the molecular formula C15H18AsN4 and a molecular weight of 329.26 g/mol.
| Compound Name | CID 87167842 |
|---|---|
| PubChem CID | 87167842 |
| Molecular Formula | C15H18AsN4 |
| Molecular Weight | 329.26 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | — |
| SMILES | C[As]C1CN(c2cnnc(NCc3ccccc3)c2)C1 |
| InChI | InChI=1S/C15H18AsN4/c1-16-13-10-20(11-13)14-7-15(19-18-9-14)17-8-12-5-3-2-4-6-12/h2-7,9,13H,8,10-11H2,1H3,(H,17,19) |
| InChIKey | WSYTWVXAOJJJRW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.26 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|