C29H38N4O4 — CID 58228544
[ethyl(methyl)amino]methyl 2-[4-[2-amino-4-[3-hydroxypropyl(propyl)carbamoyl]-3H-1-benzazepin-8-yl]phenyl]acetate (PubChem CID 58228544) has the molecular formula C29H38N4O4 and a molecular weight of 506.65 g/mol. Its IUPAC name is [ethyl(methyl)amino]methyl 2-[4-[2-amino-4-[3-hydroxypropyl(propyl)carbamoyl]-3H-1-benzazepin-8-yl]phenyl]acetate.
| Compound Name | [ethyl(methyl)amino]methyl 2-[4-[2-amino-4-[3-hydroxypropyl(propyl)carbamoyl]-3H-1-benzazepin-8-yl]phenyl]acetate |
|---|---|
| PubChem CID | 58228544 |
| Molecular Formula | C29H38N4O4 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | [ethyl(methyl)amino]methyl 2-[4-[2-amino-4-[3-hydroxypropyl(propyl)carbamoyl]-3H-1-benzazepin-8-yl]phenyl]acetate |
| SMILES | CCCN(CCCO)C(=O)C1=Cc2ccc(-c3ccc(CC(=O)OCN(C)CC)cc3)cc2N=C(N)C1 |
| InChI | InChI=1S/C29H38N4O4/c1-4-13-33(14-6-15-34)29(36)25-17-24-12-11-23(18-26(24)31-27(30)19-25)22-9-7-21(8-10-22)16-28(35)37-20-32(3)5-2/h7-12,17-18,34H,4-6,13-16,19-20H2,1-3H3,(H2,30,31) |
| InChIKey | CXJCBOWPXYOCEL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 108.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|