C20H14F2N2O3S2 — CID 58229340
N-[2-fluoro-4-(6-fluoro-2-methylquinolin-4-yl)oxyphenyl]thiophene-2-sulfonamide (PubChem CID 58229340) has the molecular formula C20H14F2N2O3S2 and a molecular weight of 432.47 g/mol. Its IUPAC name is N-[2-fluoro-4-(6-fluoro-2-methylquinolin-4-yl)oxyphenyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-fluoro-4-(6-fluoro-2-methylquinolin-4-yl)oxyphenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 58229340 |
| Molecular Formula | C20H14F2N2O3S2 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | N-[2-fluoro-4-(6-fluoro-2-methylquinolin-4-yl)oxyphenyl]thiophene-2-sulfonamide |
| SMILES | Cc1cc(Oc2ccc(NS(=O)(=O)c3cccs3)c(F)c2)c2cc(F)ccc2n1 |
| InChI | InChI=1S/C20H14F2N2O3S2/c1-12-9-19(15-10-13(21)4-6-17(15)23-12)27-14-5-7-18(16(22)11-14)24-29(25,26)20-3-2-8-28-20/h2-11,24H,1H3 |
| InChIKey | OXWPLBYTLHGMLY-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |