C21H23ClN4O3S — CID 58229455
N-[2-chloro-5-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]quinolin-6-yl]-3-pyridinyl]methanesulfonamide (PubChem CID 58229455) has the molecular formula C21H23ClN4O3S and a molecular weight of 446.96 g/mol. Its IUPAC name is N-[2-chloro-5-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]quinolin-6-yl]-3-pyridinyl]methanesulfonamide.
| Compound Name | N-[2-chloro-5-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]quinolin-6-yl]-3-pyridinyl]methanesulfonamide |
|---|---|
| PubChem CID | 58229455 |
| Molecular Formula | C21H23ClN4O3S |
| Molecular Weight | 446.96 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | N-[2-chloro-5-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]quinolin-6-yl]-3-pyridinyl]methanesulfonamide |
| SMILES | C[C@@H]1CN(c2ccnc3ccc(-c4cnc(Cl)c(NS(C)(=O)=O)c4)cc23)C[C@@H](C)O1 |
| InChI | InChI=1S/C21H23ClN4O3S/c1-13-11-26(12-14(2)29-13)20-6-7-23-18-5-4-15(8-17(18)20)16-9-19(21(22)24-10-16)25-30(3,27)28/h4-10,13-14,25H,11-12H2,1-3H3/t13-,14-/m1/s1 |
| InChIKey | HXJZKJDWNSLBHJ-ZIAGYGMSSA-N |
| XLogP | 3.94 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.96 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|