C22H26ClN5O4S — CID 58229462
4-[6-[6-chloro-5-[[2-methoxyethyl(methyl)sulfamoyl]amino]-3-pyridinyl]quinolin-4-yl]morpholine (PubChem CID 58229462) has the molecular formula C22H26ClN5O4S and a molecular weight of 492.00 g/mol. Its IUPAC name is 4-[6-[6-chloro-5-[[2-methoxyethyl(methyl)sulfamoyl]amino]-3-pyridinyl]quinolin-4-yl]morpholine.
| Compound Name | 4-[6-[6-chloro-5-[[2-methoxyethyl(methyl)sulfamoyl]amino]-3-pyridinyl]quinolin-4-yl]morpholine |
|---|---|
| PubChem CID | 58229462 |
| Molecular Formula | C22H26ClN5O4S |
| Molecular Weight | 492.00 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | 4-[6-[6-chloro-5-[[2-methoxyethyl(methyl)sulfamoyl]amino]-3-pyridinyl]quinolin-4-yl]morpholine |
| SMILES | COCCN(C)S(=O)(=O)Nc1cc(-c2ccc3nccc(N4CCOCC4)c3c2)cnc1Cl |
| InChI | InChI=1S/C22H26ClN5O4S/c1-27(7-10-31-2)33(29,30)26-20-14-17(15-25-22(20)23)16-3-4-19-18(13-16)21(5-6-24-19)28-8-11-32-12-9-28/h3-6,13-15,26H,7-12H2,1-2H3 |
| InChIKey | PQOMMGBYVVJPOS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.00 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|