C31H33ClFN5O4S — CID 58229466
tert-butyl 3-[2-[7-[6-chloro-5-[(4-fluorophenyl)sulfonylamino]-3-pyridinyl]quinoxalin-2-yl]ethyl]piperidine-1-carboxylate (PubChem CID 58229466) has the molecular formula C31H33ClFN5O4S and a molecular weight of 626.15 g/mol. Its IUPAC name is tert-butyl 3-[2-[7-[6-chloro-5-[(4-fluorophenyl)sulfonylamino]-3-pyridinyl]quinoxalin-2-yl]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-[7-[6-chloro-5-[(4-fluorophenyl)sulfonylamino]-3-pyridinyl]quinoxalin-2-yl]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58229466 |
| Molecular Formula | C31H33ClFN5O4S |
| Molecular Weight | 626.15 g/mol |
| Exact Mass | 625.19 |
| IUPAC Name | tert-butyl 3-[2-[7-[6-chloro-5-[(4-fluorophenyl)sulfonylamino]-3-pyridinyl]quinoxalin-2-yl]ethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(CCc2cnc3ccc(-c4cnc(Cl)c(NS(=O)(=O)c5ccc(F)cc5)c4)cc3n2)C1 |
| InChI | InChI=1S/C31H33ClFN5O4S/c1-31(2,3)42-30(39)38-14-4-5-20(19-38)6-10-24-18-34-26-13-7-21(15-27(26)36-24)22-16-28(29(32)35-17-22)37-43(40,41)25-11-8-23(33)9-12-25/h7-9,11-13,15-18,20,37H,4-6,10,14,19H2,1-3H3 |
| InChIKey | DFTAKCCDVCSYPQ-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.15 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|