C22H24ClN5O4S — CID 58229500
N-[2-chloro-5-(4-morpholin-4-ylquinolin-6-yl)-3-pyridinyl]morpholine-4-sulfonamide (PubChem CID 58229500) has the molecular formula C22H24ClN5O4S and a molecular weight of 489.99 g/mol. Its IUPAC name is N-[2-chloro-5-(4-morpholin-4-ylquinolin-6-yl)-3-pyridinyl]morpholine-4-sulfonamide.
| Compound Name | N-[2-chloro-5-(4-morpholin-4-ylquinolin-6-yl)-3-pyridinyl]morpholine-4-sulfonamide |
|---|---|
| PubChem CID | 58229500 |
| Molecular Formula | C22H24ClN5O4S |
| Molecular Weight | 489.99 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | N-[2-chloro-5-(4-morpholin-4-ylquinolin-6-yl)-3-pyridinyl]morpholine-4-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(-c2ccc3nccc(N4CCOCC4)c3c2)cnc1Cl)N1CCOCC1 |
| InChI | InChI=1S/C22H24ClN5O4S/c23-22-20(26-33(29,30)28-7-11-32-12-8-28)14-17(15-25-22)16-1-2-19-18(13-16)21(3-4-24-19)27-5-9-31-10-6-27/h1-4,13-15,26H,5-12H2 |
| InChIKey | IGJNWMLEKNAFBM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.99 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|