About 8-hydroxy-2-[4-(1,1,1-trifluoropropan-2-yloxy)phenyl]-2-azaspiro[4.5]decan-1-one
8-hydroxy-2-[4-(1,1,1-trifluoropropan-2-yloxy)phenyl]-2-azaspiro[4.5]decan-1-one (PubChem CID 58230115) has the molecular formula C18H22F3NO3
and a molecular weight of 357.37 g/mol. Its IUPAC name is 8-hydroxy-2-[4-(1,1,1-trifluoropropan-2-yloxy)phenyl]-2-azaspiro[4.5]decan-1-one.
Molecular Properties
| Compound Name | 8-hydroxy-2-[4-(1,1,1-trifluoropropan-2-yloxy)phenyl]-2-azaspiro[4.5]decan-1-one |
| PubChem CID | 58230115 |
| Molecular Formula | C18H22F3NO3 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 8-hydroxy-2-[4-(1,1,1-trifluoropropan-2-yloxy)phenyl]-2-azaspiro[4.5]decan-1-one |
| SMILES | CC(Oc1ccc(N2CCC3(CCC(O)CC3)C2=O)cc1)C(F)(F)F |
| InChI | InChI=1S/C18H22F3NO3/c1-12(18(19,20)21)25-15-4-2-13(3-5-15)22-11-10-17(16(22)24)8-6-14(23)7-9-17/h2-5,12,14,23H,6-11H2,1H3 |
| InChIKey | RHVNLQFFFNALIE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-hydroxy-2-[4-(1,1,1-trifluoropropan-2-yloxy)phenyl]-2-azaspiro[4.5]decan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-hydroxy-2-[4-(1,1,1-trifluoropropan-2-yloxy)phenyl]-2-azaspiro[4.5]decan-1-one?
The IUPAC name of 8-hydroxy-2-[4-(1,1,1-trifluoropropan-2-yloxy)phenyl]-2-azaspiro[4.5]decan-1-one (CID 58230115) is 8-hydroxy-2-[4-(1,1,1-trifluoropropan-2-yloxy)phenyl]-2-azaspiro[4.5]decan-1-one.
What is the SMILES notation for 8-hydroxy-2-[4-(1,1,1-trifluoropropan-2-yloxy)phenyl]-2-azaspiro[4.5]decan-1-one?
The canonical SMILES for 8-hydroxy-2-[4-(1,1,1-trifluoropropan-2-yloxy)phenyl]-2-azaspiro[4.5]decan-1-one is CC(Oc1ccc(N2CCC3(CCC(O)CC3)C2=O)cc1)C(F)(F)F.
What is the InChIKey of 8-hydroxy-2-[4-(1,1,1-trifluoropropan-2-yloxy)phenyl]-2-azaspiro[4.5]decan-1-one?
The InChIKey is RHVNLQFFFNALIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22F3NO3/c1-12(18(19,20)21)25-15-4-2-13(3-5-15)22-11-10-17(16(22)24)8-6-14(23)7-9-17/h2-5,12,14,23H,6-11H2,1H3.
What are the key properties of 8-hydroxy-2-[4-(1,1,1-trifluoropropan-2-yloxy)phenyl]-2-azaspiro[4.5]decan-1-one?
8-hydroxy-2-[4-(1,1,1-trifluoropropan-2-yloxy)phenyl]-2-azaspiro[4.5]decan-1-one has a molecular weight of 357.37 g/mol, XLogP of 3.67, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hydroxy-2-[4-(1,1,1-trifluoropropan-2-yloxy)phenyl]-2-azaspiro[4.5]decan-1-one is sourced from PubChem (CID 58230115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).