C25H21N5O4S2 — CID 58234963
5-[1-(4-methylphenyl)sulfonylindol-4-yl]-7-morpholin-4-yl-[1,3]thiazolo[5,4-d]pyrimidine-2-carbaldehyde (PubChem CID 58234963) has the molecular formula C25H21N5O4S2 and a molecular weight of 519.61 g/mol. Its IUPAC name is 5-[1-(4-methylphenyl)sulfonylindol-4-yl]-7-morpholin-4-yl-[1,3]thiazolo[5,4-d]pyrimidine-2-carbaldehyde.
| Compound Name | 5-[1-(4-methylphenyl)sulfonylindol-4-yl]-7-morpholin-4-yl-[1,3]thiazolo[5,4-d]pyrimidine-2-carbaldehyde |
|---|---|
| PubChem CID | 58234963 |
| Molecular Formula | C25H21N5O4S2 |
| Molecular Weight | 519.61 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | 5-[1-(4-methylphenyl)sulfonylindol-4-yl]-7-morpholin-4-yl-[1,3]thiazolo[5,4-d]pyrimidine-2-carbaldehyde |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c(-c4nc(N5CCOCC5)c5nc(C=O)sc5n4)cccc32)cc1 |
| InChI | InChI=1S/C25H21N5O4S2/c1-16-5-7-17(8-6-16)36(32,33)30-10-9-18-19(3-2-4-20(18)30)23-27-24(29-11-13-34-14-12-29)22-25(28-23)35-21(15-31)26-22/h2-10,15H,11-14H2,1H3 |
| InChIKey | MJMBZOLNIPMKIT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 107.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.61 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|