C22H19FN4O — CID 58235286
5-[3-[2-(6-amino-3-pyridinyl)ethynyl]-2-methyl-4-pyridinyl]-2-fluoro-N,N-dimethylbenzamide (PubChem CID 58235286) has the molecular formula C22H19FN4O and a molecular weight of 374.42 g/mol. Its IUPAC name is 5-[3-[2-(6-amino-3-pyridinyl)ethynyl]-2-methyl-4-pyridinyl]-2-fluoro-N,N-dimethylbenzamide.
| Compound Name | 5-[3-[2-(6-amino-3-pyridinyl)ethynyl]-2-methyl-4-pyridinyl]-2-fluoro-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 58235286 |
| Molecular Formula | C22H19FN4O |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 5-[3-[2-(6-amino-3-pyridinyl)ethynyl]-2-methyl-4-pyridinyl]-2-fluoro-N,N-dimethylbenzamide |
| SMILES | Cc1nccc(-c2ccc(F)c(C(=O)N(C)C)c2)c1C#Cc1ccc(N)nc1 |
| InChI | InChI=1S/C22H19FN4O/c1-14-17(7-4-15-5-9-21(24)26-13-15)18(10-11-25-14)16-6-8-20(23)19(12-16)22(28)27(2)3/h5-6,8-13H,1-3H3,(H2,24,26) |
| InChIKey | SMORIFPZBBKLIZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|