C24H28ClF3N2O2 — CID 58238855
2-chloro-N-[(3S,6S)-6-[[(1R)-1-[3-methyl-5-(trifluoromethyl)phenyl]ethoxy]methyl]-6-phenylpiperidin-3-yl]acetamide (PubChem CID 58238855) has the molecular formula C24H28ClF3N2O2 and a molecular weight of 468.95 g/mol. Its IUPAC name is 2-chloro-N-[(3S,6S)-6-[[(1R)-1-[3-methyl-5-(trifluoromethyl)phenyl]ethoxy]methyl]-6-phenylpiperidin-3-yl]acetamide.
| Compound Name | 2-chloro-N-[(3S,6S)-6-[[(1R)-1-[3-methyl-5-(trifluoromethyl)phenyl]ethoxy]methyl]-6-phenylpiperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 58238855 |
| Molecular Formula | C24H28ClF3N2O2 |
| Molecular Weight | 468.95 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 2-chloro-N-[(3S,6S)-6-[[(1R)-1-[3-methyl-5-(trifluoromethyl)phenyl]ethoxy]methyl]-6-phenylpiperidin-3-yl]acetamide |
| SMILES | Cc1cc([C@@H](C)OC[C@@]2(c3ccccc3)CC[C@H](NC(=O)CCl)CN2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H28ClF3N2O2/c1-16-10-18(12-20(11-16)24(26,27)28)17(2)32-15-23(19-6-4-3-5-7-19)9-8-21(14-29-23)30-22(31)13-25/h3-7,10-12,17,21,29H,8-9,13-15H2,1-2H3,(H,30,31)/t17-,21+,23-/m1/s1 |
| InChIKey | PXDYLFZDJWXGLD-FRGLQRNOSA-N |
| XLogP | 5.09 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.95 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|