C19H23ClF6N2O2 — CID 23574934
N-[6-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxymethyl]-6-methylpiperidin-3-yl]-2-chloroacetamide (PubChem CID 23574934) has the molecular formula C19H23ClF6N2O2 and a molecular weight of 460.85 g/mol. Its IUPAC name is N-[6-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxymethyl]-6-methylpiperidin-3-yl]-2-chloroacetamide.
| Compound Name | N-[6-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxymethyl]-6-methylpiperidin-3-yl]-2-chloroacetamide |
|---|---|
| PubChem CID | 23574934 |
| Molecular Formula | C19H23ClF6N2O2 |
| Molecular Weight | 460.85 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | N-[6-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxymethyl]-6-methylpiperidin-3-yl]-2-chloroacetamide |
| SMILES | CC(OCC1(C)CCC(NC(=O)CCl)CN1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H23ClF6N2O2/c1-11(12-5-13(18(21,22)23)7-14(6-12)19(24,25)26)30-10-17(2)4-3-15(9-27-17)28-16(29)8-20/h5-7,11,15,27H,3-4,8-10H2,1-2H3,(H,28,29) |
| InChIKey | AUAYSCOSLLKTHJ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.85 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|