C19H24ClF6N3O2 — CID 59088548
1-[(3S,6R)-6-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-6-methylpiperidin-3-yl]-3-(chloromethyl)urea (PubChem CID 59088548) has the molecular formula C19H24ClF6N3O2 and a molecular weight of 475.86 g/mol. Its IUPAC name is 1-[(3S,6R)-6-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-6-methylpiperidin-3-yl]-3-(chloromethyl)urea.
| Compound Name | 1-[(3S,6R)-6-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-6-methylpiperidin-3-yl]-3-(chloromethyl)urea |
|---|---|
| PubChem CID | 59088548 |
| Molecular Formula | C19H24ClF6N3O2 |
| Molecular Weight | 475.86 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | 1-[(3S,6R)-6-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-6-methylpiperidin-3-yl]-3-(chloromethyl)urea |
| SMILES | C[C@@H](OC[C@@]1(C)CC[C@H](NC(=O)NCCl)CN1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H24ClF6N3O2/c1-11(12-5-13(18(21,22)23)7-14(6-12)19(24,25)26)31-9-17(2)4-3-15(8-28-17)29-16(30)27-10-20/h5-7,11,15,28H,3-4,8-10H2,1-2H3,(H2,27,29,30)/t11-,15+,17-/m1/s1 |
| InChIKey | GJCYRGJGAWGWKM-XQAQDONZSA-N |
| XLogP | 4.81 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.86 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|