C23H24F6N2O2 — CID 58238915
(Z,6S)-6-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-N-methoxy-6-phenylpiperidin-3-imine (PubChem CID 58238915) has the molecular formula C23H24F6N2O2 and a molecular weight of 474.45 g/mol. Its IUPAC name is (Z,6S)-6-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-N-methoxy-6-phenylpiperidin-3-imine.
| Compound Name | (Z,6S)-6-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-N-methoxy-6-phenylpiperidin-3-imine |
|---|---|
| PubChem CID | 58238915 |
| Molecular Formula | C23H24F6N2O2 |
| Molecular Weight | 474.45 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | (Z,6S)-6-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-N-methoxy-6-phenylpiperidin-3-imine |
| SMILES | CO/N=C1/CC[C@@](CO[C@H](C)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2ccccc2)NC1 |
| InChI | InChI=1S/C23H24F6N2O2/c1-15(16-10-18(22(24,25)26)12-19(11-16)23(27,28)29)33-14-21(17-6-4-3-5-7-17)9-8-20(13-30-21)31-32-2/h3-7,10-12,15,30H,8-9,13-14H2,1-2H3/b31-20-/t15-,21-/m1/s1 |
| InChIKey | HVTAKUZCAPCKKO-QOXMROIFSA-N |
| XLogP | 6.08 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.45 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|