C14H13NO5 — CID 58240558
N-(3,4-dihydroxyphenyl)-3,4-dihydroxy-5-methylbenzamide (PubChem CID 58240558) has the molecular formula C14H13NO5 and a molecular weight of 275.26 g/mol. Its IUPAC name is N-(3,4-dihydroxyphenyl)-3,4-dihydroxy-5-methylbenzamide.
| Compound Name | N-(3,4-dihydroxyphenyl)-3,4-dihydroxy-5-methylbenzamide |
|---|---|
| PubChem CID | 58240558 |
| Molecular Formula | C14H13NO5 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | N-(3,4-dihydroxyphenyl)-3,4-dihydroxy-5-methylbenzamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(O)c(O)c2)cc(O)c1O |
| InChI | InChI=1S/C14H13NO5/c1-7-4-8(5-12(18)13(7)19)14(20)15-9-2-3-10(16)11(17)6-9/h2-6,16-19H,1H3,(H,15,20) |
| InChIKey | BYYVURVJGZMROZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|