C23H18ClFN2O — CID 58240973
1-[1-[(3-aminophenyl)methyl]-5-chloro-3-(2-fluorophenyl)indol-2-yl]ethanone (PubChem CID 58240973) has the molecular formula C23H18ClFN2O and a molecular weight of 392.86 g/mol. Its IUPAC name is 1-[1-[(3-aminophenyl)methyl]-5-chloro-3-(2-fluorophenyl)indol-2-yl]ethanone.
| Compound Name | 1-[1-[(3-aminophenyl)methyl]-5-chloro-3-(2-fluorophenyl)indol-2-yl]ethanone |
|---|---|
| PubChem CID | 58240973 |
| Molecular Formula | C23H18ClFN2O |
| Molecular Weight | 392.86 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 1-[1-[(3-aminophenyl)methyl]-5-chloro-3-(2-fluorophenyl)indol-2-yl]ethanone |
| SMILES | CC(=O)c1c(-c2ccccc2F)c2cc(Cl)ccc2n1Cc1cccc(N)c1 |
| InChI | InChI=1S/C23H18ClFN2O/c1-14(28)23-22(18-7-2-3-8-20(18)25)19-12-16(24)9-10-21(19)27(23)13-15-5-4-6-17(26)11-15/h2-12H,13,26H2,1H3 |
| InChIKey | FSYOSQBRAKZODS-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.86 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|