C28H24ClN5O3 — CID 58331402
1-[(3-aminophenyl)methyl]-5-chloro-N-(cyclopropylmethyl)-3-(2,4-dioxo-1H-quinazolin-3-yl)indole-2-carboxamide (PubChem CID 58331402) has the molecular formula C28H24ClN5O3 and a molecular weight of 513.99 g/mol. Its IUPAC name is 1-[(3-aminophenyl)methyl]-5-chloro-N-(cyclopropylmethyl)-3-(2,4-dioxo-1H-quinazolin-3-yl)indole-2-carboxamide.
| Compound Name | 1-[(3-aminophenyl)methyl]-5-chloro-N-(cyclopropylmethyl)-3-(2,4-dioxo-1H-quinazolin-3-yl)indole-2-carboxamide |
|---|---|
| PubChem CID | 58331402 |
| Molecular Formula | C28H24ClN5O3 |
| Molecular Weight | 513.99 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | 1-[(3-aminophenyl)methyl]-5-chloro-N-(cyclopropylmethyl)-3-(2,4-dioxo-1H-quinazolin-3-yl)indole-2-carboxamide |
| SMILES | Nc1cccc(Cn2c(C(=O)NCC3CC3)c(-n3c(=O)[nH]c4ccccc4c3=O)c3cc(Cl)ccc32)c1 |
| InChI | InChI=1S/C28H24ClN5O3/c29-18-10-11-23-21(13-18)24(34-27(36)20-6-1-2-7-22(20)32-28(34)37)25(26(35)31-14-16-8-9-16)33(23)15-17-4-3-5-19(30)12-17/h1-7,10-13,16H,8-9,14-15,30H2,(H,31,35)(H,32,37) |
| InChIKey | AXYCVNCUVHPLAH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 114.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.99 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|