C25H29FN4O3S — CID 58242829
N-[[(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-4,5,6,7-tetrahydrocyclopenta[f]indazol-5-yl]methyl]-N-ethyl-3,5-dimethyl-1,2-oxazole-4-sulfonamide (PubChem CID 58242829) has the molecular formula C25H29FN4O3S and a molecular weight of 484.60 g/mol. Its IUPAC name is N-[[(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-4,5,6,7-tetrahydrocyclopenta[f]indazol-5-yl]methyl]-N-ethyl-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
| Compound Name | N-[[(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-4,5,6,7-tetrahydrocyclopenta[f]indazol-5-yl]methyl]-N-ethyl-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 58242829 |
| Molecular Formula | C25H29FN4O3S |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | N-[[(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-4,5,6,7-tetrahydrocyclopenta[f]indazol-5-yl]methyl]-N-ethyl-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| SMILES | CCN(C[C@H]1CCC2=Cc3c(cnn3-c3ccc(F)cc3)C[C@@]21C)S(=O)(=O)c1c(C)noc1C |
| InChI | InChI=1S/C25H29FN4O3S/c1-5-29(34(31,32)24-16(2)28-33-17(24)3)15-20-7-6-19-12-23-18(13-25(19,20)4)14-27-30(23)22-10-8-21(26)9-11-22/h8-12,14,20H,5-7,13,15H2,1-4H3/t20-,25+/m1/s1 |
| InChIKey | BWAURUGQNSCSEM-NLFFAJNJSA-N |
| XLogP | 4.68 |
| TPSA | 81.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |