C24H27N3O3 — CID 58244956
(E)-4-[6-[(E)-3-(4-ethyl-3-phenylpiperazin-1-yl)-3-oxoprop-1-enyl]-2-pyridinyl]-1-hydroxybut-3-en-2-one (PubChem CID 58244956) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is (E)-4-[6-[(E)-3-(4-ethyl-3-phenylpiperazin-1-yl)-3-oxoprop-1-enyl]-2-pyridinyl]-1-hydroxybut-3-en-2-one.
| Compound Name | (E)-4-[6-[(E)-3-(4-ethyl-3-phenylpiperazin-1-yl)-3-oxoprop-1-enyl]-2-pyridinyl]-1-hydroxybut-3-en-2-one |
|---|---|
| PubChem CID | 58244956 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | (E)-4-[6-[(E)-3-(4-ethyl-3-phenylpiperazin-1-yl)-3-oxoprop-1-enyl]-2-pyridinyl]-1-hydroxybut-3-en-2-one |
| SMILES | CCN1CCN(C(=O)/C=C/c2cccc(/C=C/C(=O)CO)n2)CC1c1ccccc1 |
| InChI | InChI=1S/C24H27N3O3/c1-2-26-15-16-27(17-23(26)19-7-4-3-5-8-19)24(30)14-12-21-10-6-9-20(25-21)11-13-22(29)18-28/h3-14,23,28H,2,15-18H2,1H3/b13-11+,14-12+ |
| InChIKey | NUZFXMXELLEMAH-PHEQNACWSA-N |
| XLogP | 2.57 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|