C22H22BrN3O3 — CID 58244899
(E)-4-[6-[(E)-3-[4-(4-bromophenyl)piperazin-1-yl]-3-oxoprop-1-enyl]-2-pyridinyl]-1-hydroxybut-3-en-2-one (PubChem CID 58244899) has the molecular formula C22H22BrN3O3 and a molecular weight of 456.34 g/mol. Its IUPAC name is (E)-4-[6-[(E)-3-[4-(4-bromophenyl)piperazin-1-yl]-3-oxoprop-1-enyl]-2-pyridinyl]-1-hydroxybut-3-en-2-one.
| Compound Name | (E)-4-[6-[(E)-3-[4-(4-bromophenyl)piperazin-1-yl]-3-oxoprop-1-enyl]-2-pyridinyl]-1-hydroxybut-3-en-2-one |
|---|---|
| PubChem CID | 58244899 |
| Molecular Formula | C22H22BrN3O3 |
| Molecular Weight | 456.34 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | (E)-4-[6-[(E)-3-[4-(4-bromophenyl)piperazin-1-yl]-3-oxoprop-1-enyl]-2-pyridinyl]-1-hydroxybut-3-en-2-one |
| SMILES | O=C(/C=C/c1cccc(/C=C/C(=O)N2CCN(c3ccc(Br)cc3)CC2)n1)CO |
| InChI | InChI=1S/C22H22BrN3O3/c23-17-4-8-20(9-5-17)25-12-14-26(15-13-25)22(29)11-7-19-3-1-2-18(24-19)6-10-21(28)16-27/h1-11,27H,12-16H2/b10-6+,11-7+ |
| InChIKey | JZMOOMOZSNBCNY-JMQWPVDRSA-N |
| XLogP | 2.78 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|