C22H25ClN4O4 — CID 75067538
N-hydroxy-3-[6-[3-[4-(4-methoxyphenyl)piperazin-1-yl]-3-oxoprop-1-enyl]-2-pyridinyl]prop-2-enamide;hydrochloride (PubChem CID 75067538) has the molecular formula C22H25ClN4O4 and a molecular weight of 444.92 g/mol. Its IUPAC name is N-hydroxy-3-[6-[3-[4-(4-methoxyphenyl)piperazin-1-yl]-3-oxoprop-1-enyl]-2-pyridinyl]prop-2-enamide;hydrochloride.
| Compound Name | N-hydroxy-3-[6-[3-[4-(4-methoxyphenyl)piperazin-1-yl]-3-oxoprop-1-enyl]-2-pyridinyl]prop-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 75067538 |
| Molecular Formula | C22H25ClN4O4 |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | N-hydroxy-3-[6-[3-[4-(4-methoxyphenyl)piperazin-1-yl]-3-oxoprop-1-enyl]-2-pyridinyl]prop-2-enamide;hydrochloride |
| SMILES | COc1ccc(N2CCN(C(=O)C=Cc3cccc(C=CC(=O)NO)n3)CC2)cc1.Cl |
| InChI | InChI=1S/C22H24N4O4.ClH/c1-30-20-9-7-19(8-10-20)25-13-15-26(16-14-25)22(28)12-6-18-4-2-3-17(23-18)5-11-21(27)24-29;/h2-12,29H,13-16H2,1H3,(H,24,27);1H |
| InChIKey | MBNMTNHLRQLKND-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|