C23H27N3O2 — CID 58245510
8-[(4-acetylphenyl)methyl]-4-benzyl-1,4,8-triazaspiro[4.5]decan-2-one (PubChem CID 58245510) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 8-[(4-acetylphenyl)methyl]-4-benzyl-1,4,8-triazaspiro[4.5]decan-2-one.
| Compound Name | 8-[(4-acetylphenyl)methyl]-4-benzyl-1,4,8-triazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 58245510 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 8-[(4-acetylphenyl)methyl]-4-benzyl-1,4,8-triazaspiro[4.5]decan-2-one |
| SMILES | CC(=O)c1ccc(CN2CCC3(CC2)NC(=O)CN3Cc2ccccc2)cc1 |
| InChI | InChI=1S/C23H27N3O2/c1-18(27)21-9-7-20(8-10-21)15-25-13-11-23(12-14-25)24-22(28)17-26(23)16-19-5-3-2-4-6-19/h2-10H,11-17H2,1H3,(H,24,28) |
| InChIKey | ZOUYIJNLQLPVIO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |