C26H28FN3O3S — CID 58246204
N-[2-[[1-[1-(4-fluorophenyl)cyclobutyl]-1,2,3,4-tetrahydroisoquinolin-7-yl]oxy]ethyl]pyridine-3-sulfonamide (PubChem CID 58246204) has the molecular formula C26H28FN3O3S and a molecular weight of 481.59 g/mol. Its IUPAC name is N-[2-[[1-[1-(4-fluorophenyl)cyclobutyl]-1,2,3,4-tetrahydroisoquinolin-7-yl]oxy]ethyl]pyridine-3-sulfonamide.
| Compound Name | N-[2-[[1-[1-(4-fluorophenyl)cyclobutyl]-1,2,3,4-tetrahydroisoquinolin-7-yl]oxy]ethyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 58246204 |
| Molecular Formula | C26H28FN3O3S |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | N-[2-[[1-[1-(4-fluorophenyl)cyclobutyl]-1,2,3,4-tetrahydroisoquinolin-7-yl]oxy]ethyl]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NCCOc1ccc2c(c1)C(C1(c3ccc(F)cc3)CCC1)NCC2)c1cccnc1 |
| InChI | InChI=1S/C26H28FN3O3S/c27-21-7-5-20(6-8-21)26(11-2-12-26)25-24-17-22(9-4-19(24)10-14-29-25)33-16-15-30-34(31,32)23-3-1-13-28-18-23/h1,3-9,13,17-18,25,29-30H,2,10-12,14-16H2 |
| InChIKey | QNDHUFPYAJWLNB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|