C28H45NO2 — CID 58246568
(3R)-1-[(3R)-3-[(R)-butoxy(phenyl)methyl]piperidin-1-yl]-3-(cyclohexylmethyl)pentan-1-one (PubChem CID 58246568) has the molecular formula C28H45NO2 and a molecular weight of 427.67 g/mol. Its IUPAC name is (3R)-1-[(3R)-3-[(R)-butoxy(phenyl)methyl]piperidin-1-yl]-3-(cyclohexylmethyl)pentan-1-one.
| Compound Name | (3R)-1-[(3R)-3-[(R)-butoxy(phenyl)methyl]piperidin-1-yl]-3-(cyclohexylmethyl)pentan-1-one |
|---|---|
| PubChem CID | 58246568 |
| Molecular Formula | C28H45NO2 |
| Molecular Weight | 427.67 g/mol |
| Exact Mass | 427.35 |
| IUPAC Name | (3R)-1-[(3R)-3-[(R)-butoxy(phenyl)methyl]piperidin-1-yl]-3-(cyclohexylmethyl)pentan-1-one |
| SMILES | CCCCO[C@@H](c1ccccc1)[C@@H]1CCCN(C(=O)C[C@H](CC)CC2CCCCC2)C1 |
| InChI | InChI=1S/C28H45NO2/c1-3-5-19-31-28(25-15-10-7-11-16-25)26-17-12-18-29(22-26)27(30)21-23(4-2)20-24-13-8-6-9-14-24/h7,10-11,15-16,23-24,26,28H,3-6,8-9,12-14,17-22H2,1-2H3/t23-,26-,28+/m1/s1 |
| InChIKey | YQULQHXEHOPGLW-RJRADHEHSA-N |
| XLogP | 7.17 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.67 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|