C13H21F2NO3 — CID 58246758
ethyl 2-acetamido-2-[(3,3-difluorocyclobutyl)methyl]butanoate (PubChem CID 58246758) has the molecular formula C13H21F2NO3 and a molecular weight of 277.31 g/mol. Its IUPAC name is ethyl 2-acetamido-2-[(3,3-difluorocyclobutyl)methyl]butanoate.
| Compound Name | ethyl 2-acetamido-2-[(3,3-difluorocyclobutyl)methyl]butanoate |
|---|---|
| PubChem CID | 58246758 |
| Molecular Formula | C13H21F2NO3 |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | ethyl 2-acetamido-2-[(3,3-difluorocyclobutyl)methyl]butanoate |
| SMILES | CCOC(=O)C(CC)(CC1CC(F)(F)C1)NC(C)=O |
| InChI | InChI=1S/C13H21F2NO3/c1-4-12(16-9(3)17,11(18)19-5-2)6-10-7-13(14,15)8-10/h10H,4-8H2,1-3H3,(H,16,17) |
| InChIKey | SZHRCQNTXZFQHT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |