C64H52N4Si — CID 58249847
5,5',6,6'-tetramethyl-1,1',3,3'-tetrakis(4-phenylphenyl)-2,2'-spirobi[1,3,2-benzodiazasilole] (PubChem CID 58249847) has the molecular formula C64H52N4Si and a molecular weight of 905.23 g/mol. Its IUPAC name is 5,5',6,6'-tetramethyl-1,1',3,3'-tetrakis(4-phenylphenyl)-2,2'-spirobi[1,3,2-benzodiazasilole].
| Compound Name | 5,5',6,6'-tetramethyl-1,1',3,3'-tetrakis(4-phenylphenyl)-2,2'-spirobi[1,3,2-benzodiazasilole] |
|---|---|
| PubChem CID | 58249847 |
| Molecular Formula | C64H52N4Si |
| Molecular Weight | 905.23 g/mol |
| Exact Mass | 904.40 |
| IUPAC Name | 5,5',6,6'-tetramethyl-1,1',3,3'-tetrakis(4-phenylphenyl)-2,2'-spirobi[1,3,2-benzodiazasilole] |
| SMILES | Cc1cc2c(cc1C)N(c1ccc(-c3ccccc3)cc1)[Si]1(N2c2ccc(-c3ccccc3)cc2)N(c2ccc(-c3ccccc3)cc2)c2cc(C)c(C)cc2N1c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C64H52N4Si/c1-45-41-61-62(42-46(45)2)66(58-35-27-54(28-36-58)50-19-11-6-12-20-50)69(65(61)57-33-25-53(26-34-57)49-17-9-5-10-18-49)67(59-37-29-55(30-38-59)51-21-13-7-14-22-51)63-43-47(3)48(4)44-64(63)68(69)60-39-31-56(32-40-60)52-23-15-8-16-24-52/h5-44H,1-4H3 |
| InChIKey | SANMJCZWQNAUIZ-UHFFFAOYSA-N |
| XLogP | 17.30 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 905.23 |
| LogP ≤ 5 | 17.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|