C16H12N4Zr — CID 58249968
bis(2-pyrrol-1-id-2-ylpyrrol-1-ide);zirconium(4+) (PubChem CID 58249968) has the molecular formula C16H12N4Zr and a molecular weight of 351.52 g/mol. Its IUPAC name is bis(2-pyrrol-1-id-2-ylpyrrol-1-ide);zirconium(4+).
| Compound Name | bis(2-pyrrol-1-id-2-ylpyrrol-1-ide);zirconium(4+) |
|---|---|
| PubChem CID | 58249968 |
| Molecular Formula | C16H12N4Zr |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | bis(2-pyrrol-1-id-2-ylpyrrol-1-ide);zirconium(4+) |
| SMILES | [Zr+4].c1c[n-]c(-c2ccc[n-]2)c1.c1c[n-]c(-c2ccc[n-]2)c1 |
| InChI | InChI=1S/2C8H6N2.Zr/c2*1-3-7(9-5-1)8-4-2-6-10-8;/h2*1-6H;/q2*-2;+4 |
| InChIKey | MPRJBRFINAXICE-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 56.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |