C16H12HfN4 — CID 58250114
hafnium(4+);bis(2-pyrrol-1-id-2-ylpyrrol-1-ide) (PubChem CID 58250114) has the molecular formula C16H12HfN4 and a molecular weight of 438.79 g/mol. Its IUPAC name is hafnium(4+);bis(2-pyrrol-1-id-2-ylpyrrol-1-ide).
| Compound Name | hafnium(4+);bis(2-pyrrol-1-id-2-ylpyrrol-1-ide) |
|---|---|
| PubChem CID | 58250114 |
| Molecular Formula | C16H12HfN4 |
| Molecular Weight | 438.79 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | hafnium(4+);bis(2-pyrrol-1-id-2-ylpyrrol-1-ide) |
| SMILES | [Hf+4].c1c[n-]c(-c2ccc[n-]2)c1.c1c[n-]c(-c2ccc[n-]2)c1 |
| InChI | InChI=1S/2C8H6N2.Hf/c2*1-3-7(9-5-1)8-4-2-6-10-8;/h2*1-6H;/q2*-2;+4 |
| InChIKey | CNMOZRCPDYXQEF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 56.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.79 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |