C52H42N4Pt — CID 58251406
bis(3-(C-methyl-N-phenylcarbonimidoyl)-N,N-diphenylbenzene-4-id-1-amine);platinum(2+) (PubChem CID 58251406) has the molecular formula C52H42N4Pt and a molecular weight of 918.01 g/mol. Its IUPAC name is bis(3-(C-methyl-N-phenylcarbonimidoyl)-N,N-diphenylbenzene-4-id-1-amine);platinum(2+).
| Compound Name | bis(3-(C-methyl-N-phenylcarbonimidoyl)-N,N-diphenylbenzene-4-id-1-amine);platinum(2+) |
|---|---|
| PubChem CID | 58251406 |
| Molecular Formula | C52H42N4Pt |
| Molecular Weight | 918.01 g/mol |
| Exact Mass | 917.31 |
| IUPAC Name | bis(3-(C-methyl-N-phenylcarbonimidoyl)-N,N-diphenylbenzene-4-id-1-amine);platinum(2+) |
| SMILES | C/C(=N\c1ccccc1)c1[c-]ccc(N(c2ccccc2)c2ccccc2)c1.C/C(=N\c1ccccc1)c1[c-]ccc(N(c2ccccc2)c2ccccc2)c1.[Pt+2] |
| InChI | InChI=1S/2C26H21N2.Pt/c2*1-21(27-23-13-5-2-6-14-23)22-12-11-19-26(20-22)28(24-15-7-3-8-16-24)25-17-9-4-10-18-25;/h2*2-11,13-20H,1H3;/q2*-1;+2/b2*27-21+; |
| InChIKey | KPKRPOYHMQBRGG-AIZYIASBSA-N |
| XLogP | 14.19 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 918.01 |
| LogP ≤ 5 | 14.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|