C14H12O4 — CID 58252707
(3-deuteriooxyphenyl)-(2,3-dideuteriooxy-4-methylphenyl)methanone (PubChem CID 58252707) has the molecular formula C14H12O4 and a molecular weight of 247.26 g/mol. Its IUPAC name is (3-deuteriooxyphenyl)-(2,3-dideuteriooxy-4-methylphenyl)methanone.
| Compound Name | (3-deuteriooxyphenyl)-(2,3-dideuteriooxy-4-methylphenyl)methanone |
|---|---|
| PubChem CID | 58252707 |
| Molecular Formula | C14H12O4 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | (3-deuteriooxyphenyl)-(2,3-dideuteriooxy-4-methylphenyl)methanone |
| SMILES | [2H]Oc1cccc(C(=O)c2ccc(C)c(O[2H])c2O[2H])c1 |
| InChI | InChI=1S/C14H12O4/c1-8-5-6-11(14(18)12(8)16)13(17)9-3-2-4-10(15)7-9/h2-7,15-16,18H,1H3/i/hD3 |
| InChIKey | FZIASXWXDBUXCG-ZRLBSURWSA-N |
| XLogP | 2.34 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|