C22H24F4N2O2 — CID 58255179
(4S)-1-[4-[(3R)-3-fluoropyrrolidin-1-yl]phenyl]-4-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]pentan-2-one (PubChem CID 58255179) has the molecular formula C22H24F4N2O2 and a molecular weight of 424.44 g/mol. Its IUPAC name is (4S)-1-[4-[(3R)-3-fluoropyrrolidin-1-yl]phenyl]-4-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]pentan-2-one.
| Compound Name | (4S)-1-[4-[(3R)-3-fluoropyrrolidin-1-yl]phenyl]-4-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]pentan-2-one |
|---|---|
| PubChem CID | 58255179 |
| Molecular Formula | C22H24F4N2O2 |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | (4S)-1-[4-[(3R)-3-fluoropyrrolidin-1-yl]phenyl]-4-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]pentan-2-one |
| SMILES | C[C@@H](CC(=O)Cc1ccc(N2CC[C@@H](F)C2)cc1)c1ccc(OCC(F)(F)F)cn1 |
| InChI | InChI=1S/C22H24F4N2O2/c1-15(21-7-6-20(12-27-21)30-14-22(24,25)26)10-19(29)11-16-2-4-18(5-3-16)28-9-8-17(23)13-28/h2-7,12,15,17H,8-11,13-14H2,1H3/t15-,17+/m0/s1 |
| InChIKey | MOUFPZDUAMJOQW-DOTOQJQBSA-N |
| XLogP | 4.88 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|