C18H17BrF2N4O2 — CID 58256359
N-[4-[2-[(4S)-2-amino-4,5-dihydro-1,3-oxazol-4-yl]ethyl]phenyl]-2-(6-bromo-2-pyridinyl)-2,2-difluoroacetamide (PubChem CID 58256359) has the molecular formula C18H17BrF2N4O2 and a molecular weight of 439.26 g/mol. Its IUPAC name is N-[4-[2-[(4S)-2-amino-4,5-dihydro-1,3-oxazol-4-yl]ethyl]phenyl]-2-(6-bromo-2-pyridinyl)-2,2-difluoroacetamide.
| Compound Name | N-[4-[2-[(4S)-2-amino-4,5-dihydro-1,3-oxazol-4-yl]ethyl]phenyl]-2-(6-bromo-2-pyridinyl)-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 58256359 |
| Molecular Formula | C18H17BrF2N4O2 |
| Molecular Weight | 439.26 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | N-[4-[2-[(4S)-2-amino-4,5-dihydro-1,3-oxazol-4-yl]ethyl]phenyl]-2-(6-bromo-2-pyridinyl)-2,2-difluoroacetamide |
| SMILES | NC1=N[C@@H](CCc2ccc(NC(=O)C(F)(F)c3cccc(Br)n3)cc2)CO1 |
| InChI | InChI=1S/C18H17BrF2N4O2/c19-15-3-1-2-14(25-15)18(20,21)16(26)23-12-7-4-11(5-8-12)6-9-13-10-27-17(22)24-13/h1-5,7-8,13H,6,9-10H2,(H2,22,24)(H,23,26)/t13-/m0/s1 |
| InChIKey | YNDFACRCDRFASR-ZDUSSCGKSA-N |
| XLogP | 3.22 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.26 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|