C17H16ClFN4O2 — CID 76747740
N-[4-[2-(2-amino-4,5-dihydro-1,3-oxazol-4-yl)ethyl]phenyl]-6-chloro-3-fluoropyridine-2-carboxamide (PubChem CID 76747740) has the molecular formula C17H16ClFN4O2 and a molecular weight of 362.79 g/mol. Its IUPAC name is N-[4-[2-(2-amino-4,5-dihydro-1,3-oxazol-4-yl)ethyl]phenyl]-6-chloro-3-fluoropyridine-2-carboxamide.
| Compound Name | N-[4-[2-(2-amino-4,5-dihydro-1,3-oxazol-4-yl)ethyl]phenyl]-6-chloro-3-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 76747740 |
| Molecular Formula | C17H16ClFN4O2 |
| Molecular Weight | 362.79 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | N-[4-[2-(2-amino-4,5-dihydro-1,3-oxazol-4-yl)ethyl]phenyl]-6-chloro-3-fluoropyridine-2-carboxamide |
| SMILES | NC1=NC(CCc2ccc(NC(=O)c3nc(Cl)ccc3F)cc2)CO1 |
| InChI | InChI=1S/C17H16ClFN4O2/c18-14-8-7-13(19)15(23-14)16(24)21-11-4-1-10(2-5-11)3-6-12-9-25-17(20)22-12/h1-2,4-5,7-8,12H,3,6,9H2,(H2,20,22)(H,21,24) |
| InChIKey | OHWZGZKSBLVUKK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.79 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|