C20H23ClN4O2 — CID 77233028
1-[4-[4-(2-amino-4,5-dihydro-1,3-oxazol-4-yl)butyl]phenyl]-3-(4-chlorophenyl)urea (PubChem CID 77233028) has the molecular formula C20H23ClN4O2 and a molecular weight of 386.88 g/mol. Its IUPAC name is 1-[4-[4-(2-amino-4,5-dihydro-1,3-oxazol-4-yl)butyl]phenyl]-3-(4-chlorophenyl)urea.
| Compound Name | 1-[4-[4-(2-amino-4,5-dihydro-1,3-oxazol-4-yl)butyl]phenyl]-3-(4-chlorophenyl)urea |
|---|---|
| PubChem CID | 77233028 |
| Molecular Formula | C20H23ClN4O2 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 1-[4-[4-(2-amino-4,5-dihydro-1,3-oxazol-4-yl)butyl]phenyl]-3-(4-chlorophenyl)urea |
| SMILES | NC1=NC(CCCCc2ccc(NC(=O)Nc3ccc(Cl)cc3)cc2)CO1 |
| InChI | InChI=1S/C20H23ClN4O2/c21-15-7-11-17(12-8-15)25-20(26)24-16-9-5-14(6-10-16)3-1-2-4-18-13-27-19(22)23-18/h5-12,18H,1-4,13H2,(H2,22,23)(H2,24,25,26) |
| InChIKey | HNTNOTOLWBNMOP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|