C17H19FN4O3 — CID 58259470
tert-butyl N-(4-fluoro-5-formylpyrimidin-2-yl)-N-[(2-methyl-4-pyridinyl)methyl]carbamate (PubChem CID 58259470) has the molecular formula C17H19FN4O3 and a molecular weight of 346.36 g/mol. Its IUPAC name is tert-butyl N-(4-fluoro-5-formylpyrimidin-2-yl)-N-[(2-methyl-4-pyridinyl)methyl]carbamate.
| Compound Name | tert-butyl N-(4-fluoro-5-formylpyrimidin-2-yl)-N-[(2-methyl-4-pyridinyl)methyl]carbamate |
|---|---|
| PubChem CID | 58259470 |
| Molecular Formula | C17H19FN4O3 |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | tert-butyl N-(4-fluoro-5-formylpyrimidin-2-yl)-N-[(2-methyl-4-pyridinyl)methyl]carbamate |
| SMILES | Cc1cc(CN(C(=O)OC(C)(C)C)c2ncc(C=O)c(F)n2)ccn1 |
| InChI | InChI=1S/C17H19FN4O3/c1-11-7-12(5-6-19-11)9-22(16(24)25-17(2,3)4)15-20-8-13(10-23)14(18)21-15/h5-8,10H,9H2,1-4H3 |
| InChIKey | ZOJXGAYBSRXBHI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 85.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|