C17H17F2N3O3 — CID 58258940
tert-butyl N-(3-fluoro-5-formyl-2-pyridinyl)-N-[(5-fluoro-3-pyridinyl)methyl]carbamate (PubChem CID 58258940) has the molecular formula C17H17F2N3O3 and a molecular weight of 349.34 g/mol. Its IUPAC name is tert-butyl N-(3-fluoro-5-formyl-2-pyridinyl)-N-[(5-fluoro-3-pyridinyl)methyl]carbamate.
| Compound Name | tert-butyl N-(3-fluoro-5-formyl-2-pyridinyl)-N-[(5-fluoro-3-pyridinyl)methyl]carbamate |
|---|---|
| PubChem CID | 58258940 |
| Molecular Formula | C17H17F2N3O3 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | tert-butyl N-(3-fluoro-5-formyl-2-pyridinyl)-N-[(5-fluoro-3-pyridinyl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1cncc(F)c1)c1ncc(C=O)cc1F |
| InChI | InChI=1S/C17H17F2N3O3/c1-17(2,3)25-16(24)22(9-11-4-13(18)8-20-6-11)15-14(19)5-12(10-23)7-21-15/h4-8,10H,9H2,1-3H3 |
| InChIKey | NUPRRTWPAPAPFE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|