C16H19FN2O3S — CID 89270445
tert-butyl N-[(4-fluorophenyl)methyl]-N-(5-formyl-4,5-dihydro-1,3-thiazol-2-yl)carbamate (PubChem CID 89270445) has the molecular formula C16H19FN2O3S and a molecular weight of 338.40 g/mol. Its IUPAC name is tert-butyl N-[(4-fluorophenyl)methyl]-N-(5-formyl-4,5-dihydro-1,3-thiazol-2-yl)carbamate.
| Compound Name | tert-butyl N-[(4-fluorophenyl)methyl]-N-(5-formyl-4,5-dihydro-1,3-thiazol-2-yl)carbamate |
|---|---|
| PubChem CID | 89270445 |
| Molecular Formula | C16H19FN2O3S |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | tert-butyl N-[(4-fluorophenyl)methyl]-N-(5-formyl-4,5-dihydro-1,3-thiazol-2-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1ccc(F)cc1)C1=NCC(C=O)S1 |
| InChI | InChI=1S/C16H19FN2O3S/c1-16(2,3)22-15(21)19(14-18-8-13(10-20)23-14)9-11-4-6-12(17)7-5-11/h4-7,10,13H,8-9H2,1-3H3 |
| InChIKey | ASAQMRQGMGISSN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|