C21H27FN2O2S — CID 168967015
tert-butyl N-(4-amino-3-ethylsulfanyl-5-methylphenyl)-N-[(4-fluorophenyl)methyl]carbamate (PubChem CID 168967015) has the molecular formula C21H27FN2O2S and a molecular weight of 390.52 g/mol. Its IUPAC name is tert-butyl N-(4-amino-3-ethylsulfanyl-5-methylphenyl)-N-[(4-fluorophenyl)methyl]carbamate.
| Compound Name | tert-butyl N-(4-amino-3-ethylsulfanyl-5-methylphenyl)-N-[(4-fluorophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 168967015 |
| Molecular Formula | C21H27FN2O2S |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | tert-butyl N-(4-amino-3-ethylsulfanyl-5-methylphenyl)-N-[(4-fluorophenyl)methyl]carbamate |
| SMILES | CCSc1cc(N(Cc2ccc(F)cc2)C(=O)OC(C)(C)C)cc(C)c1N |
| InChI | InChI=1S/C21H27FN2O2S/c1-6-27-18-12-17(11-14(2)19(18)23)24(20(25)26-21(3,4)5)13-15-7-9-16(22)10-8-15/h7-12H,6,13,23H2,1-5H3 |
| InChIKey | UCRPJZGWPWPAJH-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|