C21H25FN2O4S — CID 168966961
tert-butyl N-(3-ethylsulfanyl-5-methyl-4-nitrophenyl)-N-[(4-fluorophenyl)methyl]carbamate (PubChem CID 168966961) has the molecular formula C21H25FN2O4S and a molecular weight of 420.51 g/mol. Its IUPAC name is tert-butyl N-(3-ethylsulfanyl-5-methyl-4-nitrophenyl)-N-[(4-fluorophenyl)methyl]carbamate.
| Compound Name | tert-butyl N-(3-ethylsulfanyl-5-methyl-4-nitrophenyl)-N-[(4-fluorophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 168966961 |
| Molecular Formula | C21H25FN2O4S |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | tert-butyl N-(3-ethylsulfanyl-5-methyl-4-nitrophenyl)-N-[(4-fluorophenyl)methyl]carbamate |
| SMILES | CCSc1cc(N(Cc2ccc(F)cc2)C(=O)OC(C)(C)C)cc(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C21H25FN2O4S/c1-6-29-18-12-17(11-14(2)19(18)24(26)27)23(20(25)28-21(3,4)5)13-15-7-9-16(22)10-8-15/h7-12H,6,13H2,1-5H3 |
| InChIKey | LAVVEBWYDNOPDQ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|