C11H17NW — CID 58259823
N-[(3E)-4,5,5-trimethylhexa-1,3-dien-2-yl]ethanimine;tungsten(2+) (PubChem CID 58259823) has the molecular formula C11H17NW and a molecular weight of 347.10 g/mol. Its IUPAC name is N-[(3E)-4,5,5-trimethylhexa-1,3-dien-2-yl]ethanimine;tungsten(2+).
| Compound Name | N-[(3E)-4,5,5-trimethylhexa-1,3-dien-2-yl]ethanimine;tungsten(2+) |
|---|---|
| PubChem CID | 58259823 |
| Molecular Formula | C11H17NW |
| Molecular Weight | 347.10 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | N-[(3E)-4,5,5-trimethylhexa-1,3-dien-2-yl]ethanimine;tungsten(2+) |
| SMILES | [H]/[C-]=C(\C=C(/C)C(C)(C)C)/N=[C-]/C.[W+2] |
| InChI | InChI=1S/C11H17N.W/c1-7-12-10(3)8-9(2)11(4,5)6;/h3,8H,1-2,4-6H3;/q-2;+2/b9-8+; |
| InChIKey | GAPIMZHMDLTOAE-HRNDJLQDSA-N |
| XLogP | 3.26 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.10 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|