C12H21N — CID 132235320
N-[(3Z)-3-tert-butylpenta-1,3-dien-2-yl]propan-2-imine (PubChem CID 132235320) has the molecular formula C12H21N and a molecular weight of 179.30 g/mol. Its IUPAC name is N-[(3Z)-3-tert-butylpenta-1,3-dien-2-yl]propan-2-imine.
| Compound Name | N-[(3Z)-3-tert-butylpenta-1,3-dien-2-yl]propan-2-imine |
|---|---|
| PubChem CID | 132235320 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.30 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | N-[(3Z)-3-tert-butylpenta-1,3-dien-2-yl]propan-2-imine |
| SMILES | C/C=C(\C(=C)N=C(C)C)/C(C)(C)C |
| InChI | InChI=1S/C12H21N/c1-8-11(12(5,6)7)10(4)13-9(2)3/h8H,4H2,1-3,5-7H3/b11-8+ |
| InChIKey | YYYVNHJVRATABV-DHZHZOJOSA-N |
| XLogP | 3.70 |
| TPSA | 12.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | 245 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.30 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|