C26H50N4O — CID 58260233
(5S)-5-amino-15-(3-aminopropylamino)-1-(2-bicyclo[2.2.1]hept-5-enylmethylamino)pentadecan-6-one (PubChem CID 58260233) has the molecular formula C26H50N4O and a molecular weight of 434.71 g/mol. Its IUPAC name is (5S)-5-amino-15-(3-aminopropylamino)-1-(2-bicyclo[2.2.1]hept-5-enylmethylamino)pentadecan-6-one.
| Compound Name | (5S)-5-amino-15-(3-aminopropylamino)-1-(2-bicyclo[2.2.1]hept-5-enylmethylamino)pentadecan-6-one |
|---|---|
| PubChem CID | 58260233 |
| Molecular Formula | C26H50N4O |
| Molecular Weight | 434.71 g/mol |
| Exact Mass | 434.40 |
| IUPAC Name | (5S)-5-amino-15-(3-aminopropylamino)-1-(2-bicyclo[2.2.1]hept-5-enylmethylamino)pentadecan-6-one |
| SMILES | NCCCNCCCCCCCCCC(=O)[C@@H](N)CCCCNCC1CC2C=CC1C2 |
| InChI | InChI=1S/C26H50N4O/c27-15-10-18-29-16-8-5-3-1-2-4-6-12-26(31)25(28)11-7-9-17-30-21-24-20-22-13-14-23(24)19-22/h13-14,22-25,29-30H,1-12,15-21,27-28H2/t22?,23?,24?,25-/m0/s1 |
| InChIKey | FUXBQXYWGBOIOD-DGGBHQDZSA-N |
| XLogP | 3.91 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.71 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|