C28H58N4O — CID 58260410
(5S)-5-amino-15-(3-aminopropylamino)-1-[[(3R)-3,7-dimethyloct-6-enyl]amino]pentadecan-6-one (PubChem CID 58260410) has the molecular formula C28H58N4O and a molecular weight of 466.80 g/mol. Its IUPAC name is (5S)-5-amino-15-(3-aminopropylamino)-1-[[(3R)-3,7-dimethyloct-6-enyl]amino]pentadecan-6-one.
| Compound Name | (5S)-5-amino-15-(3-aminopropylamino)-1-[[(3R)-3,7-dimethyloct-6-enyl]amino]pentadecan-6-one |
|---|---|
| PubChem CID | 58260410 |
| Molecular Formula | C28H58N4O |
| Molecular Weight | 466.80 g/mol |
| Exact Mass | 466.46 |
| IUPAC Name | (5S)-5-amino-15-(3-aminopropylamino)-1-[[(3R)-3,7-dimethyloct-6-enyl]amino]pentadecan-6-one |
| SMILES | CC(C)=CCC[C@@H](C)CCNCCCC[C@H](N)C(=O)CCCCCCCCCNCCCN |
| InChI | InChI=1S/C28H58N4O/c1-25(2)15-13-16-26(3)19-24-32-22-12-10-17-27(30)28(33)18-9-7-5-4-6-8-11-21-31-23-14-20-29/h15,26-27,31-32H,4-14,16-24,29-30H2,1-3H3/t26-,27+/m1/s1 |
| InChIKey | GALVWDLXCPAELB-SXOMAYOGSA-N |
| XLogP | 5.47 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.80 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|