C18H30ClFN2O2S — CID 58260282
N'-[9-(2-chloro-5-fluorophenyl)sulfonylnonyl]propane-1,3-diamine (PubChem CID 58260282) has the molecular formula C18H30ClFN2O2S and a molecular weight of 392.97 g/mol. Its IUPAC name is N'-[9-(2-chloro-5-fluorophenyl)sulfonylnonyl]propane-1,3-diamine.
| Compound Name | N'-[9-(2-chloro-5-fluorophenyl)sulfonylnonyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 58260282 |
| Molecular Formula | C18H30ClFN2O2S |
| Molecular Weight | 392.97 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | N'-[9-(2-chloro-5-fluorophenyl)sulfonylnonyl]propane-1,3-diamine |
| SMILES | NCCCNCCCCCCCCCS(=O)(=O)c1cc(F)ccc1Cl |
| InChI | InChI=1S/C18H30ClFN2O2S/c19-17-10-9-16(20)15-18(17)25(23,24)14-7-5-3-1-2-4-6-12-22-13-8-11-21/h9-10,15,22H,1-8,11-14,21H2 |
| InChIKey | BRUNGZZMLKJMHE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.97 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|