C14H20ClNO2S — CID 2818889
N-[2-(4-chlorophenyl)sulfonylethyl]cyclohexanamine (PubChem CID 2818889) has the molecular formula C14H20ClNO2S and a molecular weight of 301.84 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)sulfonylethyl]cyclohexanamine.
| Compound Name | N-[2-(4-chlorophenyl)sulfonylethyl]cyclohexanamine |
|---|---|
| PubChem CID | 2818889 |
| Molecular Formula | C14H20ClNO2S |
| Molecular Weight | 301.84 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | N-[2-(4-chlorophenyl)sulfonylethyl]cyclohexanamine |
| SMILES | O=S(=O)(CCNC1CCCCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H20ClNO2S/c15-12-6-8-14(9-7-12)19(17,18)11-10-16-13-4-2-1-3-5-13/h6-9,13,16H,1-5,10-11H2 |
| InChIKey | XOFWAPGMHFSSTA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.84 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |