C16H36N5O+ — CID 58262500
2-[[6-amino-2-(1-aminoethylideneamino)-2-methylhexanoyl]amino]ethyl-diethyl-methylazanium (PubChem CID 58262500) has the molecular formula C16H36N5O+ and a molecular weight of 314.50 g/mol. Its IUPAC name is 2-[[6-amino-2-(1-aminoethylideneamino)-2-methylhexanoyl]amino]ethyl-diethyl-methylazanium.
| Compound Name | 2-[[6-amino-2-(1-aminoethylideneamino)-2-methylhexanoyl]amino]ethyl-diethyl-methylazanium |
|---|---|
| PubChem CID | 58262500 |
| Molecular Formula | C16H36N5O+ |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.29 |
| IUPAC Name | 2-[[6-amino-2-(1-aminoethylideneamino)-2-methylhexanoyl]amino]ethyl-diethyl-methylazanium |
| SMILES | CC[N+](C)(CC)CCNC(=O)C(C)(CCCCN)/N=C(\C)N |
| InChI | InChI=1S/C16H35N5O/c1-6-21(5,7-2)13-12-19-15(22)16(4,20-14(3)18)10-8-9-11-17/h6-13,17H2,1-5H3,(H2-,18,19,20,22)/p+1 |
| InChIKey | BCBICTBAJMRPFD-UHFFFAOYSA-O |
| XLogP | 0.85 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|